C29H32O6 — CID 132521285
bis(4-butoxyphenyl) 2-methylbenzene-1,4-dicarboxylate (PubChem CID 132521285) has the molecular formula C29H32O6 and a molecular weight of 476.57 g/mol. Its IUPAC name is bis(4-butoxyphenyl) 2-methylbenzene-1,4-dicarboxylate.
| Compound Name | bis(4-butoxyphenyl) 2-methylbenzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 132521285 |
| Molecular Formula | C29H32O6 |
| Molecular Weight | 476.57 g/mol |
| Exact Mass | 476.22 |
| IUPAC Name | bis(4-butoxyphenyl) 2-methylbenzene-1,4-dicarboxylate |
| SMILES | CCCCOc1ccc(OC(=O)c2ccc(C(=O)Oc3ccc(OCCCC)cc3)c(C)c2)cc1 |
| InChI | InChI=1S/C29H32O6/c1-4-6-18-32-23-9-13-25(14-10-23)34-28(30)22-8-17-27(21(3)20-22)29(31)35-26-15-11-24(12-16-26)33-19-7-5-2/h8-17,20H,4-7,18-19H2,1-3H3 |
| InChIKey | NWEBNQQFYHQGLV-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.57 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|