About bis[4-(3-oxobutanoyl)phenyl] 4-methoxybenzene-1,3-dicarboxylate
bis[4-(3-oxobutanoyl)phenyl] 4-methoxybenzene-1,3-dicarboxylate (PubChem CID 141301594) has the molecular formula C29H24O9
and a molecular weight of 516.50 g/mol. Its IUPAC name is bis[4-(3-oxobutanoyl)phenyl] 4-methoxybenzene-1,3-dicarboxylate.
Molecular Properties
| Compound Name | bis[4-(3-oxobutanoyl)phenyl] 4-methoxybenzene-1,3-dicarboxylate |
| PubChem CID | 141301594 |
| Molecular Formula | C29H24O9 |
| Molecular Weight | 516.50 g/mol |
| Exact Mass | 516.14 |
| IUPAC Name | bis[4-(3-oxobutanoyl)phenyl] 4-methoxybenzene-1,3-dicarboxylate |
| SMILES | COc1ccc(C(=O)Oc2ccc(C(=O)CC(C)=O)cc2)cc1C(=O)Oc1ccc(C(=O)CC(C)=O)cc1 |
| InChI | InChI=1S/C29H24O9/c1-17(30)14-25(32)19-4-9-22(10-5-19)37-28(34)21-8-13-27(36-3)24(16-21)29(35)38-23-11-6-20(7-12-23)26(33)15-18(2)31/h4-13,16H,14-15H2,1-3H3 |
| InChIKey | NIDABEMVFNJVKI-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 130.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 516.50 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze bis[4-(3-oxobutanoyl)phenyl] 4-methoxybenzene-1,3-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis[4-(3-oxobutanoyl)phenyl] 4-methoxybenzene-1,3-dicarboxylate?
The IUPAC name of bis[4-(3-oxobutanoyl)phenyl] 4-methoxybenzene-1,3-dicarboxylate (CID 141301594) is bis[4-(3-oxobutanoyl)phenyl] 4-methoxybenzene-1,3-dicarboxylate.
What is the SMILES notation for bis[4-(3-oxobutanoyl)phenyl] 4-methoxybenzene-1,3-dicarboxylate?
The canonical SMILES for bis[4-(3-oxobutanoyl)phenyl] 4-methoxybenzene-1,3-dicarboxylate is COc1ccc(C(=O)Oc2ccc(C(=O)CC(C)=O)cc2)cc1C(=O)Oc1ccc(C(=O)CC(C)=O)cc1.
What is the InChIKey of bis[4-(3-oxobutanoyl)phenyl] 4-methoxybenzene-1,3-dicarboxylate?
The InChIKey is NIDABEMVFNJVKI-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H24O9/c1-17(30)14-25(32)19-4-9-22(10-5-19)37-28(34)21-8-13-27(36-3)24(16-21)29(35)38-23-11-6-20(7-12-23)26(33)15-18(2)31/h4-13,16H,14-15H2,1-3H3.
What are the key properties of bis[4-(3-oxobutanoyl)phenyl] 4-methoxybenzene-1,3-dicarboxylate?
bis[4-(3-oxobutanoyl)phenyl] 4-methoxybenzene-1,3-dicarboxylate has a molecular weight of 516.50 g/mol, XLogP of 4.46, 11 rotatable bonds, 0 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for bis[4-(3-oxobutanoyl)phenyl] 4-methoxybenzene-1,3-dicarboxylate is sourced from PubChem (CID 141301594), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).