C29H24O9 — CID 141301594
bis[4-(3-oxobutanoyl)phenyl] 4-methoxybenzene-1,3-dicarboxylate (PubChem CID 141301594) has the molecular formula C29H24O9 and a molecular weight of 516.50 g/mol. Its IUPAC name is bis[4-(3-oxobutanoyl)phenyl] 4-methoxybenzene-1,3-dicarboxylate.
| Compound Name | bis[4-(3-oxobutanoyl)phenyl] 4-methoxybenzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 141301594 |
| Molecular Formula | C29H24O9 |
| Molecular Weight | 516.50 g/mol |
| Exact Mass | 516.14 |
| IUPAC Name | bis[4-(3-oxobutanoyl)phenyl] 4-methoxybenzene-1,3-dicarboxylate |
| SMILES | COc1ccc(C(=O)Oc2ccc(C(=O)CC(C)=O)cc2)cc1C(=O)Oc1ccc(C(=O)CC(C)=O)cc1 |
| InChI | InChI=1S/C29H24O9/c1-17(30)14-25(32)19-4-9-22(10-5-19)37-28(34)21-8-13-27(36-3)24(16-21)29(35)38-23-11-6-20(7-12-23)26(33)15-18(2)31/h4-13,16H,14-15H2,1-3H3 |
| InChIKey | NIDABEMVFNJVKI-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 130.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.50 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|