C33H24N4O5 — CID 175261100
bis(4-phenyldiazenylphenyl) 4-methoxybenzene-1,3-dicarboxylate (PubChem CID 175261100) has the molecular formula C33H24N4O5 and a molecular weight of 556.58 g/mol. Its IUPAC name is bis(4-phenyldiazenylphenyl) 4-methoxybenzene-1,3-dicarboxylate.
| Compound Name | bis(4-phenyldiazenylphenyl) 4-methoxybenzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 175261100 |
| Molecular Formula | C33H24N4O5 |
| Molecular Weight | 556.58 g/mol |
| Exact Mass | 556.17 |
| IUPAC Name | bis(4-phenyldiazenylphenyl) 4-methoxybenzene-1,3-dicarboxylate |
| SMILES | COc1ccc(C(=O)Oc2ccc(/N=N/c3ccccc3)cc2)cc1C(=O)Oc1ccc(/N=N/c2ccccc2)cc1 |
| InChI | InChI=1S/C33H24N4O5/c1-40-31-21-12-23(32(38)41-28-17-13-26(14-18-28)36-34-24-8-4-2-5-9-24)22-30(31)33(39)42-29-19-15-27(16-20-29)37-35-25-10-6-3-7-11-25/h2-22H,1H3/b36-34+,37-35+ |
| InChIKey | FYTKELVKJFVFIZ-VHJMTFITSA-N |
| XLogP | 8.96 |
| TPSA | 111.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.58 |
| LogP ≤ 5 | 8.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|