About (4-benzoylphenyl) 2-methoxybenzoate
(4-benzoylphenyl) 2-methoxybenzoate (PubChem CID 1234638) has the molecular formula C21H16O4
and a molecular weight of 332.36 g/mol. Its IUPAC name is (4-benzoylphenyl) 2-methoxybenzoate.
Molecular Properties
| Compound Name | (4-benzoylphenyl) 2-methoxybenzoate |
| PubChem CID | 1234638 |
| Molecular Formula | C21H16O4 |
| Molecular Weight | 332.36 g/mol |
| Exact Mass | 332.10 |
| IUPAC Name | (4-benzoylphenyl) 2-methoxybenzoate |
| SMILES | COc1ccccc1C(=O)Oc1ccc(C(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C21H16O4/c1-24-19-10-6-5-9-18(19)21(23)25-17-13-11-16(12-14-17)20(22)15-7-3-2-4-8-15/h2-14H,1H3 |
| InChIKey | ULVZJQUSCUXTCS-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.36 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (4-benzoylphenyl) 2-methoxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-benzoylphenyl) 2-methoxybenzoate?
The IUPAC name of (4-benzoylphenyl) 2-methoxybenzoate (CID 1234638) is (4-benzoylphenyl) 2-methoxybenzoate.
What is the SMILES notation for (4-benzoylphenyl) 2-methoxybenzoate?
The canonical SMILES for (4-benzoylphenyl) 2-methoxybenzoate is COc1ccccc1C(=O)Oc1ccc(C(=O)c2ccccc2)cc1.
What is the InChIKey of (4-benzoylphenyl) 2-methoxybenzoate?
The InChIKey is ULVZJQUSCUXTCS-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H16O4/c1-24-19-10-6-5-9-18(19)21(23)25-17-13-11-16(12-14-17)20(22)15-7-3-2-4-8-15/h2-14H,1H3.
What are the key properties of (4-benzoylphenyl) 2-methoxybenzoate?
(4-benzoylphenyl) 2-methoxybenzoate has a molecular weight of 332.36 g/mol, XLogP of 4.15, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-benzoylphenyl) 2-methoxybenzoate is sourced from PubChem (CID 1234638), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).