About 2-methoxybenzoic acid;phenyl hydrogen carbonate
2-methoxybenzoic acid;phenyl hydrogen carbonate (PubChem CID 66629291) has the molecular formula C15H14O6
and a molecular weight of 290.27 g/mol. Its IUPAC name is 2-methoxybenzoic acid;phenyl hydrogen carbonate.
Molecular Properties
| Compound Name | 2-methoxybenzoic acid;phenyl hydrogen carbonate |
| PubChem CID | 66629291 |
| Molecular Formula | C15H14O6 |
| Molecular Weight | 290.27 g/mol |
| Exact Mass | 290.08 |
| IUPAC Name | 2-methoxybenzoic acid;phenyl hydrogen carbonate |
| SMILES | COc1ccccc1C(=O)O.O=C(O)Oc1ccccc1 |
| InChI | InChI=1S/C8H8O3.C7H6O3/c1-11-7-5-3-2-4-6(7)8(9)10;8-7(9)10-6-4-2-1-3-5-6/h2-5H,1H3,(H,9,10);1-5H,(H,8,9) |
| InChIKey | DVLQAYXHSPHFLF-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.27 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|
Analyze 2-methoxybenzoic acid;phenyl hydrogen carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxybenzoic acid;phenyl hydrogen carbonate?
The IUPAC name of 2-methoxybenzoic acid;phenyl hydrogen carbonate (CID 66629291) is 2-methoxybenzoic acid;phenyl hydrogen carbonate.
What is the SMILES notation for 2-methoxybenzoic acid;phenyl hydrogen carbonate?
The canonical SMILES for 2-methoxybenzoic acid;phenyl hydrogen carbonate is COc1ccccc1C(=O)O.O=C(O)Oc1ccccc1.
What is the InChIKey of 2-methoxybenzoic acid;phenyl hydrogen carbonate?
The InChIKey is DVLQAYXHSPHFLF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8O3.C7H6O3/c1-11-7-5-3-2-4-6(7)8(9)10;8-7(9)10-6-4-2-1-3-5-6/h2-5H,1H3,(H,9,10);1-5H,(H,8,9).
What are the key properties of 2-methoxybenzoic acid;phenyl hydrogen carbonate?
2-methoxybenzoic acid;phenyl hydrogen carbonate has a molecular weight of 290.27 g/mol, XLogP of 3.14, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxybenzoic acid;phenyl hydrogen carbonate is sourced from PubChem (CID 66629291), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).