About 2-difluorothallanyloxybenzoic acid;2-methoxybenzoic acid
2-difluorothallanyloxybenzoic acid;2-methoxybenzoic acid (PubChem CID 142039253) has the molecular formula C15H13F2O6Tl
and a molecular weight of 531.64 g/mol. Its IUPAC name is 2-difluorothallanyloxybenzoic acid;2-methoxybenzoic acid.
Molecular Properties
| Compound Name | 2-difluorothallanyloxybenzoic acid;2-methoxybenzoic acid |
| PubChem CID | 142039253 |
| Molecular Formula | C15H13F2O6Tl |
| Molecular Weight | 531.64 g/mol |
| Exact Mass | 532.04 |
| IUPAC Name | 2-difluorothallanyloxybenzoic acid;2-methoxybenzoic acid |
| SMILES | COc1ccccc1C(=O)O.O=C(O)c1ccccc1O[Tl](F)F |
| InChI | InChI=1S/C8H8O3.C7H6O3.2FH.Tl/c1-11-7-5-3-2-4-6(7)8(9)10;8-6-4-2-1-3-5(6)7(9)10;;;/h2-5H,1H3,(H,9,10);1-4,8H,(H,9,10);2*1H;/q;;;;+3/p-3 |
| InChIKey | HQJDLBBZYYBZAE-UHFFFAOYSA-K |
| XLogP | 3.08 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 531.64 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-difluorothallanyloxybenzoic acid;2-methoxybenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-difluorothallanyloxybenzoic acid;2-methoxybenzoic acid?
The IUPAC name of 2-difluorothallanyloxybenzoic acid;2-methoxybenzoic acid (CID 142039253) is 2-difluorothallanyloxybenzoic acid;2-methoxybenzoic acid.
What is the SMILES notation for 2-difluorothallanyloxybenzoic acid;2-methoxybenzoic acid?
The canonical SMILES for 2-difluorothallanyloxybenzoic acid;2-methoxybenzoic acid is COc1ccccc1C(=O)O.O=C(O)c1ccccc1O[Tl](F)F.
What is the InChIKey of 2-difluorothallanyloxybenzoic acid;2-methoxybenzoic acid?
The InChIKey is HQJDLBBZYYBZAE-UHFFFAOYSA-K. The full InChI is InChI=1S/C8H8O3.C7H6O3.2FH.Tl/c1-11-7-5-3-2-4-6(7)8(9)10;8-6-4-2-1-3-5(6)7(9)10;;;/h2-5H,1H3,(H,9,10);1-4,8H,(H,9,10);2*1H;/q;;;;+3/p-3.
What are the key properties of 2-difluorothallanyloxybenzoic acid;2-methoxybenzoic acid?
2-difluorothallanyloxybenzoic acid;2-methoxybenzoic acid has a molecular weight of 531.64 g/mol, XLogP of 3.08, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-difluorothallanyloxybenzoic acid;2-methoxybenzoic acid is sourced from PubChem (CID 142039253), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).