About 2-methoxybenzoyl iodide
2-methoxybenzoyl iodide (PubChem CID 139677083) has the molecular formula C8H7IO2
and a molecular weight of 262.05 g/mol. Its IUPAC name is 2-methoxybenzoyl iodide.
Molecular Properties
| Compound Name | 2-methoxybenzoyl iodide |
| PubChem CID | 139677083 |
| Molecular Formula | C8H7IO2 |
| Molecular Weight | 262.05 g/mol |
| Exact Mass | 261.95 |
| IUPAC Name | 2-methoxybenzoyl iodide |
| SMILES | COc1ccccc1C(=O)I |
| InChI | InChI=1S/C8H7IO2/c1-11-7-5-3-2-4-6(7)8(9)10/h2-5H,1H3 |
| InChIKey | JJDYYTXPYLMYLN-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.05 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-methoxybenzoyl iodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxybenzoyl iodide?
The IUPAC name of 2-methoxybenzoyl iodide (CID 139677083) is 2-methoxybenzoyl iodide.
What is the SMILES notation for 2-methoxybenzoyl iodide?
The canonical SMILES for 2-methoxybenzoyl iodide is COc1ccccc1C(=O)I.
What is the InChIKey of 2-methoxybenzoyl iodide?
The InChIKey is JJDYYTXPYLMYLN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7IO2/c1-11-7-5-3-2-4-6(7)8(9)10/h2-5H,1H3.
What are the key properties of 2-methoxybenzoyl iodide?
2-methoxybenzoyl iodide has a molecular weight of 262.05 g/mol, XLogP of 2.27, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxybenzoyl iodide is sourced from PubChem (CID 139677083), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).