C15H12I2O — CID 122376703
1-[(E)-1,2-diiodo-2-phenylethenyl]-2-methoxybenzene (PubChem CID 122376703) has the molecular formula C15H12I2O and a molecular weight of 462.07 g/mol. Its IUPAC name is 1-[(E)-1,2-diiodo-2-phenylethenyl]-2-methoxybenzene.
| Compound Name | 1-[(E)-1,2-diiodo-2-phenylethenyl]-2-methoxybenzene |
|---|---|
| PubChem CID | 122376703 |
| Molecular Formula | C15H12I2O |
| Molecular Weight | 462.07 g/mol |
| Exact Mass | 461.90 |
| IUPAC Name | 1-[(E)-1,2-diiodo-2-phenylethenyl]-2-methoxybenzene |
| SMILES | COc1ccccc1/C(I)=C(\I)c1ccccc1 |
| InChI | InChI=1S/C15H12I2O/c1-18-13-10-6-5-9-12(13)15(17)14(16)11-7-3-2-4-8-11/h2-10H,1H3/b15-14+ |
| InChIKey | NKODJCVYIVQUGI-CCEZHUSRSA-N |
| XLogP | 5.39 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.07 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|