About formaldehyde;bis(1-(2-methoxyphenyl)ethanone)
formaldehyde;bis(1-(2-methoxyphenyl)ethanone) (PubChem CID 174959963) has the molecular formula C19H22O5
and a molecular weight of 330.38 g/mol. Its IUPAC name is formaldehyde;bis(1-(2-methoxyphenyl)ethanone).
Molecular Properties
| Compound Name | formaldehyde;bis(1-(2-methoxyphenyl)ethanone) |
| PubChem CID | 174959963 |
| Molecular Formula | C19H22O5 |
| Molecular Weight | 330.38 g/mol |
| Exact Mass | 330.15 |
| IUPAC Name | formaldehyde;bis(1-(2-methoxyphenyl)ethanone) |
| SMILES | C=O.COc1ccccc1C(C)=O.COc1ccccc1C(C)=O |
| InChI | InChI=1S/2C9H10O2.CH2O/c2*1-7(10)8-5-3-4-6-9(8)11-2;1-2/h2*3-6H,1-2H3;1H2 |
| InChIKey | MMJIASUYBKKVAD-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.38 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze formaldehyde;bis(1-(2-methoxyphenyl)ethanone) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of formaldehyde;bis(1-(2-methoxyphenyl)ethanone)?
The IUPAC name of formaldehyde;bis(1-(2-methoxyphenyl)ethanone) (CID 174959963) is formaldehyde;bis(1-(2-methoxyphenyl)ethanone).
What is the SMILES notation for formaldehyde;bis(1-(2-methoxyphenyl)ethanone)?
The canonical SMILES for formaldehyde;bis(1-(2-methoxyphenyl)ethanone) is C=O.COc1ccccc1C(C)=O.COc1ccccc1C(C)=O.
What is the InChIKey of formaldehyde;bis(1-(2-methoxyphenyl)ethanone)?
The InChIKey is MMJIASUYBKKVAD-UHFFFAOYSA-N. The full InChI is InChI=1S/2C9H10O2.CH2O/c2*1-7(10)8-5-3-4-6-9(8)11-2;1-2/h2*3-6H,1-2H3;1H2.
What are the key properties of formaldehyde;bis(1-(2-methoxyphenyl)ethanone)?
formaldehyde;bis(1-(2-methoxyphenyl)ethanone) has a molecular weight of 330.38 g/mol, XLogP of 3.61, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for formaldehyde;bis(1-(2-methoxyphenyl)ethanone) is sourced from PubChem (CID 174959963), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).