About (2-acetylphenyl) methyl carbonate
(2-acetylphenyl) methyl carbonate (PubChem CID 14493761) has the molecular formula C10H10O4
and a molecular weight of 194.19 g/mol. Its IUPAC name is (2-acetylphenyl) methyl carbonate.
Molecular Properties
| Compound Name | (2-acetylphenyl) methyl carbonate |
| PubChem CID | 14493761 |
| Molecular Formula | C10H10O4 |
| Molecular Weight | 194.19 g/mol |
| Exact Mass | 194.06 |
| IUPAC Name | (2-acetylphenyl) methyl carbonate |
| SMILES | COC(=O)Oc1ccccc1C(C)=O |
| InChI | InChI=1S/C10H10O4/c1-7(11)8-5-3-4-6-9(8)14-10(12)13-2/h3-6H,1-2H3 |
| InChIKey | LPTYTOCQMDNIJI-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.19 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|
Analyze (2-acetylphenyl) methyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-acetylphenyl) methyl carbonate?
The IUPAC name of (2-acetylphenyl) methyl carbonate (CID 14493761) is (2-acetylphenyl) methyl carbonate.
What is the SMILES notation for (2-acetylphenyl) methyl carbonate?
The canonical SMILES for (2-acetylphenyl) methyl carbonate is COC(=O)Oc1ccccc1C(C)=O.
What is the InChIKey of (2-acetylphenyl) methyl carbonate?
The InChIKey is LPTYTOCQMDNIJI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10O4/c1-7(11)8-5-3-4-6-9(8)14-10(12)13-2/h3-6H,1-2H3.
What are the key properties of (2-acetylphenyl) methyl carbonate?
(2-acetylphenyl) methyl carbonate has a molecular weight of 194.19 g/mol, XLogP of 2.03, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-acetylphenyl) methyl carbonate is sourced from PubChem (CID 14493761), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).