About (2-acetylphenyl) (2-formylphenyl) carbonate;ethene
(2-acetylphenyl) (2-formylphenyl) carbonate;ethene (PubChem CID 142249621) has the molecular formula C18H16O5
and a molecular weight of 312.32 g/mol. Its IUPAC name is (2-acetylphenyl) (2-formylphenyl) carbonate;ethene.
Molecular Properties
| Compound Name | (2-acetylphenyl) (2-formylphenyl) carbonate;ethene |
| PubChem CID | 142249621 |
| Molecular Formula | C18H16O5 |
| Molecular Weight | 312.32 g/mol |
| Exact Mass | 312.10 |
| IUPAC Name | (2-acetylphenyl) (2-formylphenyl) carbonate;ethene |
| SMILES | C=C.CC(=O)c1ccccc1OC(=O)Oc1ccccc1C=O |
| InChI | InChI=1S/C16H12O5.C2H4/c1-11(18)13-7-3-5-9-15(13)21-16(19)20-14-8-4-2-6-12(14)10-17;1-2/h2-10H,1H3;1-2H2 |
| InChIKey | ZLLIPDVNSMSPPE-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.32 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|
Analyze (2-acetylphenyl) (2-formylphenyl) carbonate;ethene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-acetylphenyl) (2-formylphenyl) carbonate;ethene?
The IUPAC name of (2-acetylphenyl) (2-formylphenyl) carbonate;ethene (CID 142249621) is (2-acetylphenyl) (2-formylphenyl) carbonate;ethene.
What is the SMILES notation for (2-acetylphenyl) (2-formylphenyl) carbonate;ethene?
The canonical SMILES for (2-acetylphenyl) (2-formylphenyl) carbonate;ethene is C=C.CC(=O)c1ccccc1OC(=O)Oc1ccccc1C=O.
What is the InChIKey of (2-acetylphenyl) (2-formylphenyl) carbonate;ethene?
The InChIKey is ZLLIPDVNSMSPPE-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12O5.C2H4/c1-11(18)13-7-3-5-9-15(13)21-16(19)20-14-8-4-2-6-12(14)10-17;1-2/h2-10H,1H3;1-2H2.
What are the key properties of (2-acetylphenyl) (2-formylphenyl) carbonate;ethene?
(2-acetylphenyl) (2-formylphenyl) carbonate;ethene has a molecular weight of 312.32 g/mol, XLogP of 4.08, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2-acetylphenyl) (2-formylphenyl) carbonate;ethene is sourced from PubChem (CID 142249621), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).