About (2-acetylphenyl) 2-bromoacetate
(2-acetylphenyl) 2-bromoacetate (PubChem CID 58158821) has the molecular formula C10H9BrO3
and a molecular weight of 257.08 g/mol. Its IUPAC name is (2-acetylphenyl) 2-bromoacetate.
Molecular Properties
| Compound Name | (2-acetylphenyl) 2-bromoacetate |
| PubChem CID | 58158821 |
| Molecular Formula | C10H9BrO3 |
| Molecular Weight | 257.08 g/mol |
| Exact Mass | 255.97 |
| IUPAC Name | (2-acetylphenyl) 2-bromoacetate |
| SMILES | CC(=O)c1ccccc1OC(=O)CBr |
| InChI | InChI=1S/C10H9BrO3/c1-7(12)8-4-2-3-5-9(8)14-10(13)6-11/h2-5H,6H2,1H3 |
| InChIKey | PVUZVIGSNHSVKQ-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.08 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (2-acetylphenyl) 2-bromoacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-acetylphenyl) 2-bromoacetate?
The IUPAC name of (2-acetylphenyl) 2-bromoacetate (CID 58158821) is (2-acetylphenyl) 2-bromoacetate.
What is the SMILES notation for (2-acetylphenyl) 2-bromoacetate?
The canonical SMILES for (2-acetylphenyl) 2-bromoacetate is CC(=O)c1ccccc1OC(=O)CBr.
What is the InChIKey of (2-acetylphenyl) 2-bromoacetate?
The InChIKey is PVUZVIGSNHSVKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9BrO3/c1-7(12)8-4-2-3-5-9(8)14-10(13)6-11/h2-5H,6H2,1H3.
What are the key properties of (2-acetylphenyl) 2-bromoacetate?
(2-acetylphenyl) 2-bromoacetate has a molecular weight of 257.08 g/mol, XLogP of 2.19, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-acetylphenyl) 2-bromoacetate is sourced from PubChem (CID 58158821), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).