C22H18O3 — CID 134840846
(2-acetylphenyl) 2,2-diphenylacetate (PubChem CID 134840846) has the molecular formula C22H18O3 and a molecular weight of 330.38 g/mol. Its IUPAC name is (2-acetylphenyl) 2,2-diphenylacetate.
| Compound Name | (2-acetylphenyl) 2,2-diphenylacetate |
|---|---|
| PubChem CID | 134840846 |
| Molecular Formula | C22H18O3 |
| Molecular Weight | 330.38 g/mol |
| Exact Mass | 330.13 |
| IUPAC Name | (2-acetylphenyl) 2,2-diphenylacetate |
| SMILES | CC(=O)c1ccccc1OC(=O)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H18O3/c1-16(23)19-14-8-9-15-20(19)25-22(24)21(17-10-4-2-5-11-17)18-12-6-3-7-13-18/h2-15,21H,1H3 |
| InChIKey | WVSJZEUPWRLTCY-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.38 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|