About (2-acetylphenyl) (3-hydroxy-4-methoxyphenyl) carbonate
(2-acetylphenyl) (3-hydroxy-4-methoxyphenyl) carbonate (PubChem CID 54197243) has the molecular formula C16H14O6
and a molecular weight of 302.28 g/mol. Its IUPAC name is (2-acetylphenyl) (3-hydroxy-4-methoxyphenyl) carbonate.
Molecular Properties
| Compound Name | (2-acetylphenyl) (3-hydroxy-4-methoxyphenyl) carbonate |
| PubChem CID | 54197243 |
| Molecular Formula | C16H14O6 |
| Molecular Weight | 302.28 g/mol |
| Exact Mass | 302.08 |
| IUPAC Name | (2-acetylphenyl) (3-hydroxy-4-methoxyphenyl) carbonate |
| SMILES | COc1ccc(OC(=O)Oc2ccccc2C(C)=O)cc1O |
| InChI | InChI=1S/C16H14O6/c1-10(17)12-5-3-4-6-14(12)22-16(19)21-11-7-8-15(20-2)13(18)9-11/h3-9,18H,1-2H3 |
| InChIKey | PMRYBNRYBRZNAD-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.28 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|
Analyze (2-acetylphenyl) (3-hydroxy-4-methoxyphenyl) carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-acetylphenyl) (3-hydroxy-4-methoxyphenyl) carbonate?
The IUPAC name of (2-acetylphenyl) (3-hydroxy-4-methoxyphenyl) carbonate (CID 54197243) is (2-acetylphenyl) (3-hydroxy-4-methoxyphenyl) carbonate.
What is the SMILES notation for (2-acetylphenyl) (3-hydroxy-4-methoxyphenyl) carbonate?
The canonical SMILES for (2-acetylphenyl) (3-hydroxy-4-methoxyphenyl) carbonate is COc1ccc(OC(=O)Oc2ccccc2C(C)=O)cc1O.
What is the InChIKey of (2-acetylphenyl) (3-hydroxy-4-methoxyphenyl) carbonate?
The InChIKey is PMRYBNRYBRZNAD-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14O6/c1-10(17)12-5-3-4-6-14(12)22-16(19)21-11-7-8-15(20-2)13(18)9-11/h3-9,18H,1-2H3.
What are the key properties of (2-acetylphenyl) (3-hydroxy-4-methoxyphenyl) carbonate?
(2-acetylphenyl) (3-hydroxy-4-methoxyphenyl) carbonate has a molecular weight of 302.28 g/mol, XLogP of 3.18, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2-acetylphenyl) (3-hydroxy-4-methoxyphenyl) carbonate is sourced from PubChem (CID 54197243), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).