About (3-hydroxy-4-methoxyphenyl) (2-hydroxyphenyl) carbonate
(3-hydroxy-4-methoxyphenyl) (2-hydroxyphenyl) carbonate (PubChem CID 54293633) has the molecular formula C14H12O6
and a molecular weight of 276.24 g/mol. Its IUPAC name is (3-hydroxy-4-methoxyphenyl) (2-hydroxyphenyl) carbonate.
Molecular Properties
| Compound Name | (3-hydroxy-4-methoxyphenyl) (2-hydroxyphenyl) carbonate |
| PubChem CID | 54293633 |
| Molecular Formula | C14H12O6 |
| Molecular Weight | 276.24 g/mol |
| Exact Mass | 276.06 |
| IUPAC Name | (3-hydroxy-4-methoxyphenyl) (2-hydroxyphenyl) carbonate |
| SMILES | COc1ccc(OC(=O)Oc2ccccc2O)cc1O |
| InChI | InChI=1S/C14H12O6/c1-18-12-7-6-9(8-11(12)16)19-14(17)20-13-5-3-2-4-10(13)15/h2-8,15-16H,1H3 |
| InChIKey | RZGJRYIAIJCOCG-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.24 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|
Analyze (3-hydroxy-4-methoxyphenyl) (2-hydroxyphenyl) carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-hydroxy-4-methoxyphenyl) (2-hydroxyphenyl) carbonate?
The IUPAC name of (3-hydroxy-4-methoxyphenyl) (2-hydroxyphenyl) carbonate (CID 54293633) is (3-hydroxy-4-methoxyphenyl) (2-hydroxyphenyl) carbonate.
What is the SMILES notation for (3-hydroxy-4-methoxyphenyl) (2-hydroxyphenyl) carbonate?
The canonical SMILES for (3-hydroxy-4-methoxyphenyl) (2-hydroxyphenyl) carbonate is COc1ccc(OC(=O)Oc2ccccc2O)cc1O.
What is the InChIKey of (3-hydroxy-4-methoxyphenyl) (2-hydroxyphenyl) carbonate?
The InChIKey is RZGJRYIAIJCOCG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12O6/c1-18-12-7-6-9(8-11(12)16)19-14(17)20-13-5-3-2-4-10(13)15/h2-8,15-16H,1H3.
What are the key properties of (3-hydroxy-4-methoxyphenyl) (2-hydroxyphenyl) carbonate?
(3-hydroxy-4-methoxyphenyl) (2-hydroxyphenyl) carbonate has a molecular weight of 276.24 g/mol, XLogP of 2.68, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (3-hydroxy-4-methoxyphenyl) (2-hydroxyphenyl) carbonate is sourced from PubChem (CID 54293633), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).