C10H13NO4 — CID 125485691
(2-hydroxy-4-methoxyphenyl) N,N-dimethylcarbamate (PubChem CID 125485691) has the molecular formula C10H13NO4 and a molecular weight of 211.22 g/mol. Its IUPAC name is (2-hydroxy-4-methoxyphenyl) N,N-dimethylcarbamate.
| Compound Name | (2-hydroxy-4-methoxyphenyl) N,N-dimethylcarbamate |
|---|---|
| PubChem CID | 125485691 |
| Molecular Formula | C10H13NO4 |
| Molecular Weight | 211.22 g/mol |
| Exact Mass | 211.08 |
| IUPAC Name | (2-hydroxy-4-methoxyphenyl) N,N-dimethylcarbamate |
| SMILES | COc1ccc(OC(=O)N(C)C)c(O)c1 |
| InChI | InChI=1S/C10H13NO4/c1-11(2)10(13)15-9-5-4-7(14-3)6-8(9)12/h4-6,12H,1-3H3 |
| InChIKey | AYRSFNVKZOZYOQ-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.22 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |