C13H20N2O3 — CID 43085475
2-(2,5-dimethoxyanilino)-N,N-dimethylpropanamide (PubChem CID 43085475) has the molecular formula C13H20N2O3 and a molecular weight of 252.31 g/mol. Its IUPAC name is 2-(2,5-dimethoxyanilino)-N,N-dimethylpropanamide.
| Compound Name | 2-(2,5-dimethoxyanilino)-N,N-dimethylpropanamide |
|---|---|
| PubChem CID | 43085475 |
| Molecular Formula | C13H20N2O3 |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.15 |
| IUPAC Name | 2-(2,5-dimethoxyanilino)-N,N-dimethylpropanamide |
| SMILES | COc1ccc(OC)c(NC(C)C(=O)N(C)C)c1 |
| InChI | InChI=1S/C13H20N2O3/c1-9(13(16)15(2)3)14-11-8-10(17-4)6-7-12(11)18-5/h6-9,14H,1-5H3 |
| InChIKey | YAAYPGZLCLDULM-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |