C16H26N2O2 — CID 9044303
(2R)-2-(5-tert-butyl-2-methoxyanilino)-N,N-dimethylpropanamide (PubChem CID 9044303) has the molecular formula C16H26N2O2 and a molecular weight of 278.40 g/mol. Its IUPAC name is (2R)-2-(5-tert-butyl-2-methoxyanilino)-N,N-dimethylpropanamide.
| Compound Name | (2R)-2-(5-tert-butyl-2-methoxyanilino)-N,N-dimethylpropanamide |
|---|---|
| PubChem CID | 9044303 |
| Molecular Formula | C16H26N2O2 |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.20 |
| IUPAC Name | (2R)-2-(5-tert-butyl-2-methoxyanilino)-N,N-dimethylpropanamide |
| SMILES | COc1ccc(C(C)(C)C)cc1N[C@H](C)C(=O)N(C)C |
| InChI | InChI=1S/C16H26N2O2/c1-11(15(19)18(5)6)17-13-10-12(16(2,3)4)8-9-14(13)20-7/h8-11,17H,1-7H3/t11-/m1/s1 |
| InChIKey | GNJKWSZEMTWSDG-LLVKDONJSA-N |
| XLogP | 2.88 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |