C17H28N2O2 — CID 103928652
(2R)-2-amino-N-(5-tert-butyl-2-methoxyphenyl)-3,3-dimethylbutanamide (PubChem CID 103928652) has the molecular formula C17H28N2O2 and a molecular weight of 292.42 g/mol. Its IUPAC name is (2R)-2-amino-N-(5-tert-butyl-2-methoxyphenyl)-3,3-dimethylbutanamide.
| Compound Name | (2R)-2-amino-N-(5-tert-butyl-2-methoxyphenyl)-3,3-dimethylbutanamide |
|---|---|
| PubChem CID | 103928652 |
| Molecular Formula | C17H28N2O2 |
| Molecular Weight | 292.42 g/mol |
| Exact Mass | 292.22 |
| IUPAC Name | (2R)-2-amino-N-(5-tert-butyl-2-methoxyphenyl)-3,3-dimethylbutanamide |
| SMILES | COc1ccc(C(C)(C)C)cc1NC(=O)[C@H](N)C(C)(C)C |
| InChI | InChI=1S/C17H28N2O2/c1-16(2,3)11-8-9-13(21-7)12(10-11)19-15(20)14(18)17(4,5)6/h8-10,14H,18H2,1-7H3,(H,19,20)/t14-/m0/s1 |
| InChIKey | BKYQELKZBRHSEZ-AWEZNQCLSA-N |
| XLogP | 3.30 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.42 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |