C14H22N2O3 — CID 61148145
(2S)-2-amino-N-(2,4-dimethoxyphenyl)-3,3-dimethylbutanamide (PubChem CID 61148145) has the molecular formula C14H22N2O3 and a molecular weight of 266.34 g/mol. Its IUPAC name is (2S)-2-amino-N-(2,4-dimethoxyphenyl)-3,3-dimethylbutanamide.
| Compound Name | (2S)-2-amino-N-(2,4-dimethoxyphenyl)-3,3-dimethylbutanamide |
|---|---|
| PubChem CID | 61148145 |
| Molecular Formula | C14H22N2O3 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.16 |
| IUPAC Name | (2S)-2-amino-N-(2,4-dimethoxyphenyl)-3,3-dimethylbutanamide |
| SMILES | COc1ccc(NC(=O)[C@@H](N)C(C)(C)C)c(OC)c1 |
| InChI | InChI=1S/C14H22N2O3/c1-14(2,3)12(15)13(17)16-10-7-6-9(18-4)8-11(10)19-5/h6-8,12H,15H2,1-5H3,(H,16,17)/t12-/m1/s1 |
| InChIKey | SMPXIRHKIOUAGZ-GFCCVEGCSA-N |
| XLogP | 2.02 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |