C22H28ClNO2 — CID 7935933
(2S)-N-(5-tert-butyl-2-methoxyphenyl)-2-(4-chlorophenyl)-3-methylbutanamide (PubChem CID 7935933) has the molecular formula C22H28ClNO2 and a molecular weight of 373.92 g/mol. Its IUPAC name is (2S)-N-(5-tert-butyl-2-methoxyphenyl)-2-(4-chlorophenyl)-3-methylbutanamide.
| Compound Name | (2S)-N-(5-tert-butyl-2-methoxyphenyl)-2-(4-chlorophenyl)-3-methylbutanamide |
|---|---|
| PubChem CID | 7935933 |
| Molecular Formula | C22H28ClNO2 |
| Molecular Weight | 373.92 g/mol |
| Exact Mass | 373.18 |
| IUPAC Name | (2S)-N-(5-tert-butyl-2-methoxyphenyl)-2-(4-chlorophenyl)-3-methylbutanamide |
| SMILES | COc1ccc(C(C)(C)C)cc1NC(=O)[C@H](c1ccc(Cl)cc1)C(C)C |
| InChI | InChI=1S/C22H28ClNO2/c1-14(2)20(15-7-10-17(23)11-8-15)21(25)24-18-13-16(22(3,4)5)9-12-19(18)26-6/h7-14,20H,1-6H3,(H,24,25)/t20-/m0/s1 |
| InChIKey | OIEWGQBGZCFFCH-FQEVSTJZSA-N |
| XLogP | 6.02 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.92 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |