C17H16ClF2NO — CID 7958855
(2S)-2-(4-chlorophenyl)-N-(2,5-difluorophenyl)-3-methylbutanamide (PubChem CID 7958855) has the molecular formula C17H16ClF2NO and a molecular weight of 323.77 g/mol. Its IUPAC name is (2S)-2-(4-chlorophenyl)-N-(2,5-difluorophenyl)-3-methylbutanamide.
| Compound Name | (2S)-2-(4-chlorophenyl)-N-(2,5-difluorophenyl)-3-methylbutanamide |
|---|---|
| PubChem CID | 7958855 |
| Molecular Formula | C17H16ClF2NO |
| Molecular Weight | 323.77 g/mol |
| Exact Mass | 323.09 |
| IUPAC Name | (2S)-2-(4-chlorophenyl)-N-(2,5-difluorophenyl)-3-methylbutanamide |
| SMILES | CC(C)[C@H](C(=O)Nc1cc(F)ccc1F)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H16ClF2NO/c1-10(2)16(11-3-5-12(18)6-4-11)17(22)21-15-9-13(19)7-8-14(15)20/h3-10,16H,1-2H3,(H,21,22)/t16-/m0/s1 |
| InChIKey | YDOKVOCOJKRZFC-INIZCTEOSA-N |
| XLogP | 5.00 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.77 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |