C19H22ClNO — CID 3680613
2-(4-chlorophenyl)-N-(2,3-dimethylphenyl)-3-methylbutanamide (PubChem CID 3680613) has the molecular formula C19H22ClNO and a molecular weight of 315.84 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-N-(2,3-dimethylphenyl)-3-methylbutanamide.
| Compound Name | 2-(4-chlorophenyl)-N-(2,3-dimethylphenyl)-3-methylbutanamide |
|---|---|
| PubChem CID | 3680613 |
| Molecular Formula | C19H22ClNO |
| Molecular Weight | 315.84 g/mol |
| Exact Mass | 315.14 |
| IUPAC Name | 2-(4-chlorophenyl)-N-(2,3-dimethylphenyl)-3-methylbutanamide |
| SMILES | Cc1cccc(NC(=O)C(c2ccc(Cl)cc2)C(C)C)c1C |
| InChI | InChI=1S/C19H22ClNO/c1-12(2)18(15-8-10-16(20)11-9-15)19(22)21-17-7-5-6-13(3)14(17)4/h5-12,18H,1-4H3,(H,21,22) |
| InChIKey | GGYWMUKDUZZFPD-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.84 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |