C24H24ClNO — CID 2457506
(2R)-N-(2-benzylphenyl)-2-(4-chlorophenyl)-3-methylbutanamide (PubChem CID 2457506) has the molecular formula C24H24ClNO and a molecular weight of 377.92 g/mol. Its IUPAC name is (2R)-N-(2-benzylphenyl)-2-(4-chlorophenyl)-3-methylbutanamide.
| Compound Name | (2R)-N-(2-benzylphenyl)-2-(4-chlorophenyl)-3-methylbutanamide |
|---|---|
| PubChem CID | 2457506 |
| Molecular Formula | C24H24ClNO |
| Molecular Weight | 377.92 g/mol |
| Exact Mass | 377.15 |
| IUPAC Name | (2R)-N-(2-benzylphenyl)-2-(4-chlorophenyl)-3-methylbutanamide |
| SMILES | CC(C)[C@@H](C(=O)Nc1ccccc1Cc1ccccc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C24H24ClNO/c1-17(2)23(19-12-14-21(25)15-13-19)24(27)26-22-11-7-6-10-20(22)16-18-8-4-3-5-9-18/h3-15,17,23H,16H2,1-2H3,(H,26,27)/t23-/m1/s1 |
| InChIKey | HQKGETOCAFJSJI-HSZRJFAPSA-N |
| XLogP | 6.31 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.92 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |