C23H22F2N2O — CID 9377065
N-(2-benzylphenyl)-2-[[(1R)-1-(3,4-difluorophenyl)ethyl]amino]acetamide (PubChem CID 9377065) has the molecular formula C23H22F2N2O and a molecular weight of 380.44 g/mol. Its IUPAC name is N-(2-benzylphenyl)-2-[[(1R)-1-(3,4-difluorophenyl)ethyl]amino]acetamide.
| Compound Name | N-(2-benzylphenyl)-2-[[(1R)-1-(3,4-difluorophenyl)ethyl]amino]acetamide |
|---|---|
| PubChem CID | 9377065 |
| Molecular Formula | C23H22F2N2O |
| Molecular Weight | 380.44 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | N-(2-benzylphenyl)-2-[[(1R)-1-(3,4-difluorophenyl)ethyl]amino]acetamide |
| SMILES | C[C@@H](NCC(=O)Nc1ccccc1Cc1ccccc1)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C23H22F2N2O/c1-16(18-11-12-20(24)21(25)14-18)26-15-23(28)27-22-10-6-5-9-19(22)13-17-7-3-2-4-8-17/h2-12,14,16,26H,13,15H2,1H3,(H,27,28)/t16-/m1/s1 |
| InChIKey | SAAGZRONKRZEIU-MRXNPFEDSA-N |
| XLogP | 4.84 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.44 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |