C23H20F2N2O2 — CID 9376956
N-(2-benzoylphenyl)-2-[[(1R)-1-(3,4-difluorophenyl)ethyl]amino]acetamide (PubChem CID 9376956) has the molecular formula C23H20F2N2O2 and a molecular weight of 394.42 g/mol. Its IUPAC name is N-(2-benzoylphenyl)-2-[[(1R)-1-(3,4-difluorophenyl)ethyl]amino]acetamide.
| Compound Name | N-(2-benzoylphenyl)-2-[[(1R)-1-(3,4-difluorophenyl)ethyl]amino]acetamide |
|---|---|
| PubChem CID | 9376956 |
| Molecular Formula | C23H20F2N2O2 |
| Molecular Weight | 394.42 g/mol |
| Exact Mass | 394.15 |
| IUPAC Name | N-(2-benzoylphenyl)-2-[[(1R)-1-(3,4-difluorophenyl)ethyl]amino]acetamide |
| SMILES | C[C@@H](NCC(=O)Nc1ccccc1C(=O)c1ccccc1)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C23H20F2N2O2/c1-15(17-11-12-19(24)20(25)13-17)26-14-22(28)27-21-10-6-5-9-18(21)23(29)16-7-3-2-4-8-16/h2-13,15,26H,14H2,1H3,(H,27,28)/t15-/m1/s1 |
| InChIKey | OTGQQEDXKSKIRT-OAHLLOKOSA-N |
| XLogP | 4.49 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.42 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |