C20H18F2N2O — CID 9376373
2-[[(1R)-1-(3,4-difluorophenyl)ethyl]amino]-N-naphthalen-1-ylacetamide (PubChem CID 9376373) has the molecular formula C20H18F2N2O and a molecular weight of 340.37 g/mol. Its IUPAC name is 2-[[(1R)-1-(3,4-difluorophenyl)ethyl]amino]-N-naphthalen-1-ylacetamide.
| Compound Name | 2-[[(1R)-1-(3,4-difluorophenyl)ethyl]amino]-N-naphthalen-1-ylacetamide |
|---|---|
| PubChem CID | 9376373 |
| Molecular Formula | C20H18F2N2O |
| Molecular Weight | 340.37 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | 2-[[(1R)-1-(3,4-difluorophenyl)ethyl]amino]-N-naphthalen-1-ylacetamide |
| SMILES | C[C@@H](NCC(=O)Nc1cccc2ccccc12)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C20H18F2N2O/c1-13(15-9-10-17(21)18(22)11-15)23-12-20(25)24-19-8-4-6-14-5-2-3-7-16(14)19/h2-11,13,23H,12H2,1H3,(H,24,25)/t13-/m1/s1 |
| InChIKey | FETGPWXRTADXRN-CYBMUJFWSA-N |
| XLogP | 4.41 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.37 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |