C23H23F2N2O+ — CID 9377062
[2-(2-benzylanilino)-2-oxoethyl]-[(1S)-1-(3,4-difluorophenyl)ethyl]azanium (PubChem CID 9377062) has the molecular formula C23H23F2N2O+ and a molecular weight of 381.45 g/mol. Its IUPAC name is [2-(2-benzylanilino)-2-oxoethyl]-[(1S)-1-(3,4-difluorophenyl)ethyl]azanium.
| Compound Name | [2-(2-benzylanilino)-2-oxoethyl]-[(1S)-1-(3,4-difluorophenyl)ethyl]azanium |
|---|---|
| PubChem CID | 9377062 |
| Molecular Formula | C23H23F2N2O+ |
| Molecular Weight | 381.45 g/mol |
| Exact Mass | 381.18 |
| IUPAC Name | [2-(2-benzylanilino)-2-oxoethyl]-[(1S)-1-(3,4-difluorophenyl)ethyl]azanium |
| SMILES | C[C@H]([NH2+]CC(=O)Nc1ccccc1Cc1ccccc1)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C23H22F2N2O/c1-16(18-11-12-20(24)21(25)14-18)26-15-23(28)27-22-10-6-5-9-19(22)13-17-7-3-2-4-8-17/h2-12,14,16,26H,13,15H2,1H3,(H,27,28)/p+1/t16-/m0/s1 |
| InChIKey | SAAGZRONKRZEIU-INIZCTEOSA-O |
| XLogP | 3.82 |
| TPSA | 45.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.45 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |