C20H21Cl2NO3 — CID 7209293
[2-(3-chloro-2-methylanilino)-2-oxoethyl] (2R)-2-(4-chlorophenyl)-3-methylbutanoate (PubChem CID 7209293) has the molecular formula C20H21Cl2NO3 and a molecular weight of 394.30 g/mol. Its IUPAC name is [2-(3-chloro-2-methylanilino)-2-oxoethyl] (2R)-2-(4-chlorophenyl)-3-methylbutanoate.
| Compound Name | [2-(3-chloro-2-methylanilino)-2-oxoethyl] (2R)-2-(4-chlorophenyl)-3-methylbutanoate |
|---|---|
| PubChem CID | 7209293 |
| Molecular Formula | C20H21Cl2NO3 |
| Molecular Weight | 394.30 g/mol |
| Exact Mass | 393.09 |
| IUPAC Name | [2-(3-chloro-2-methylanilino)-2-oxoethyl] (2R)-2-(4-chlorophenyl)-3-methylbutanoate |
| SMILES | Cc1c(Cl)cccc1NC(=O)COC(=O)[C@@H](c1ccc(Cl)cc1)C(C)C |
| InChI | InChI=1S/C20H21Cl2NO3/c1-12(2)19(14-7-9-15(21)10-8-14)20(25)26-11-18(24)23-17-6-4-5-16(22)13(17)3/h4-10,12,19H,11H2,1-3H3,(H,23,24)/t19-/m1/s1 |
| InChIKey | VYECKGGDYZDGQK-LJQANCHMSA-N |
| XLogP | 5.22 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.30 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |