C20H19ClN2O3 — CID 7133370
[2-(3-cyanoanilino)-2-oxoethyl] (2R)-2-(4-chlorophenyl)-3-methylbutanoate (PubChem CID 7133370) has the molecular formula C20H19ClN2O3 and a molecular weight of 370.84 g/mol. Its IUPAC name is [2-(3-cyanoanilino)-2-oxoethyl] (2R)-2-(4-chlorophenyl)-3-methylbutanoate.
| Compound Name | [2-(3-cyanoanilino)-2-oxoethyl] (2R)-2-(4-chlorophenyl)-3-methylbutanoate |
|---|---|
| PubChem CID | 7133370 |
| Molecular Formula | C20H19ClN2O3 |
| Molecular Weight | 370.84 g/mol |
| Exact Mass | 370.11 |
| IUPAC Name | [2-(3-cyanoanilino)-2-oxoethyl] (2R)-2-(4-chlorophenyl)-3-methylbutanoate |
| SMILES | CC(C)[C@@H](C(=O)OCC(=O)Nc1cccc(C#N)c1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H19ClN2O3/c1-13(2)19(15-6-8-16(21)9-7-15)20(25)26-12-18(24)23-17-5-3-4-14(10-17)11-22/h3-10,13,19H,12H2,1-2H3,(H,23,24)/t19-/m1/s1 |
| InChIKey | KJAKTEQSSRRGQT-LJQANCHMSA-N |
| XLogP | 4.13 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.84 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |