C15H11ClN2OS — CID 734703
2-(4-chlorophenyl)sulfanyl-N-(3-cyanophenyl)acetamide (PubChem CID 734703) has the molecular formula C15H11ClN2OS and a molecular weight of 302.79 g/mol. Its IUPAC name is 2-(4-chlorophenyl)sulfanyl-N-(3-cyanophenyl)acetamide.
| Compound Name | 2-(4-chlorophenyl)sulfanyl-N-(3-cyanophenyl)acetamide |
|---|---|
| PubChem CID | 734703 |
| Molecular Formula | C15H11ClN2OS |
| Molecular Weight | 302.79 g/mol |
| Exact Mass | 302.03 |
| IUPAC Name | 2-(4-chlorophenyl)sulfanyl-N-(3-cyanophenyl)acetamide |
| SMILES | N#Cc1cccc(NC(=O)CSc2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C15H11ClN2OS/c16-12-4-6-14(7-5-12)20-10-15(19)18-13-3-1-2-11(8-13)9-17/h1-8H,10H2,(H,18,19) |
| InChIKey | RHRHGYIGZOAHSQ-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.79 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |