C24H17ClN4O2S — CID 46925274
2-[3-[(4-chlorophenyl)methyl]-4-oxoquinazolin-2-yl]sulfanyl-N-(3-cyanophenyl)acetamide (PubChem CID 46925274) has the molecular formula C24H17ClN4O2S and a molecular weight of 460.95 g/mol. Its IUPAC name is 2-[3-[(4-chlorophenyl)methyl]-4-oxoquinazolin-2-yl]sulfanyl-N-(3-cyanophenyl)acetamide.
| Compound Name | 2-[3-[(4-chlorophenyl)methyl]-4-oxoquinazolin-2-yl]sulfanyl-N-(3-cyanophenyl)acetamide |
|---|---|
| PubChem CID | 46925274 |
| Molecular Formula | C24H17ClN4O2S |
| Molecular Weight | 460.95 g/mol |
| Exact Mass | 460.08 |
| IUPAC Name | 2-[3-[(4-chlorophenyl)methyl]-4-oxoquinazolin-2-yl]sulfanyl-N-(3-cyanophenyl)acetamide |
| SMILES | N#Cc1cccc(NC(=O)CSc2nc3ccccc3c(=O)n2Cc2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C24H17ClN4O2S/c25-18-10-8-16(9-11-18)14-29-23(31)20-6-1-2-7-21(20)28-24(29)32-15-22(30)27-19-5-3-4-17(12-19)13-26/h1-12H,14-15H2,(H,27,30) |
| InChIKey | NIRZXOKXYWDQAM-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 87.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.95 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |