C23H17ClFN3O2S — CID 2618941
N-(3-chlorophenyl)-2-[3-[(4-fluorophenyl)methyl]-4-oxoquinazolin-2-yl]sulfanylacetamide (PubChem CID 2618941) has the molecular formula C23H17ClFN3O2S and a molecular weight of 453.93 g/mol. Its IUPAC name is N-(3-chlorophenyl)-2-[3-[(4-fluorophenyl)methyl]-4-oxoquinazolin-2-yl]sulfanylacetamide.
| Compound Name | N-(3-chlorophenyl)-2-[3-[(4-fluorophenyl)methyl]-4-oxoquinazolin-2-yl]sulfanylacetamide |
|---|---|
| PubChem CID | 2618941 |
| Molecular Formula | C23H17ClFN3O2S |
| Molecular Weight | 453.93 g/mol |
| Exact Mass | 453.07 |
| IUPAC Name | N-(3-chlorophenyl)-2-[3-[(4-fluorophenyl)methyl]-4-oxoquinazolin-2-yl]sulfanylacetamide |
| SMILES | O=C(CSc1nc2ccccc2c(=O)n1Cc1ccc(F)cc1)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C23H17ClFN3O2S/c24-16-4-3-5-18(12-16)26-21(29)14-31-23-27-20-7-2-1-6-19(20)22(30)28(23)13-15-8-10-17(25)11-9-15/h1-12H,13-14H2,(H,26,29) |
| InChIKey | SHRMBURIOOKPCI-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.93 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |