C23H20N4O4S2 — CID 55318349
2-(3-benzyl-4-oxoquinazolin-2-yl)sulfanyl-N-(3-sulfamoylphenyl)acetamide (PubChem CID 55318349) has the molecular formula C23H20N4O4S2 and a molecular weight of 480.57 g/mol. Its IUPAC name is 2-(3-benzyl-4-oxoquinazolin-2-yl)sulfanyl-N-(3-sulfamoylphenyl)acetamide.
| Compound Name | 2-(3-benzyl-4-oxoquinazolin-2-yl)sulfanyl-N-(3-sulfamoylphenyl)acetamide |
|---|---|
| PubChem CID | 55318349 |
| Molecular Formula | C23H20N4O4S2 |
| Molecular Weight | 480.57 g/mol |
| Exact Mass | 480.09 |
| IUPAC Name | 2-(3-benzyl-4-oxoquinazolin-2-yl)sulfanyl-N-(3-sulfamoylphenyl)acetamide |
| SMILES | NS(=O)(=O)c1cccc(NC(=O)CSc2nc3ccccc3c(=O)n2Cc2ccccc2)c1 |
| InChI | InChI=1S/C23H20N4O4S2/c24-33(30,31)18-10-6-9-17(13-18)25-21(28)15-32-23-26-20-12-5-4-11-19(20)22(29)27(23)14-16-7-2-1-3-8-16/h1-13H,14-15H2,(H,25,28)(H2,24,30,31) |
| InChIKey | QQZOPEPGNNUMRH-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 124.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.57 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |