C18H16ClN3O2S — CID 7265656
2-[3-[(4-chlorophenyl)methyl]-4-oxoquinazolin-2-yl]sulfanyl-N-methylacetamide (PubChem CID 7265656) has the molecular formula C18H16ClN3O2S and a molecular weight of 373.87 g/mol. Its IUPAC name is 2-[3-[(4-chlorophenyl)methyl]-4-oxoquinazolin-2-yl]sulfanyl-N-methylacetamide.
| Compound Name | 2-[3-[(4-chlorophenyl)methyl]-4-oxoquinazolin-2-yl]sulfanyl-N-methylacetamide |
|---|---|
| PubChem CID | 7265656 |
| Molecular Formula | C18H16ClN3O2S |
| Molecular Weight | 373.87 g/mol |
| Exact Mass | 373.07 |
| IUPAC Name | 2-[3-[(4-chlorophenyl)methyl]-4-oxoquinazolin-2-yl]sulfanyl-N-methylacetamide |
| SMILES | CNC(=O)CSc1nc2ccccc2c(=O)n1Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H16ClN3O2S/c1-20-16(23)11-25-18-21-15-5-3-2-4-14(15)17(24)22(18)10-12-6-8-13(19)9-7-12/h2-9H,10-11H2,1H3,(H,20,23) |
| InChIKey | IZPSFGGWTXMDPK-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.87 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |