C18H16N2O3S — CID 7806663
[2-(3-cyanoanilino)-2-oxoethyl] (2S)-2-phenylsulfanylpropanoate (PubChem CID 7806663) has the molecular formula C18H16N2O3S and a molecular weight of 340.40 g/mol. Its IUPAC name is [2-(3-cyanoanilino)-2-oxoethyl] (2S)-2-phenylsulfanylpropanoate.
| Compound Name | [2-(3-cyanoanilino)-2-oxoethyl] (2S)-2-phenylsulfanylpropanoate |
|---|---|
| PubChem CID | 7806663 |
| Molecular Formula | C18H16N2O3S |
| Molecular Weight | 340.40 g/mol |
| Exact Mass | 340.09 |
| IUPAC Name | [2-(3-cyanoanilino)-2-oxoethyl] (2S)-2-phenylsulfanylpropanoate |
| SMILES | C[C@H](Sc1ccccc1)C(=O)OCC(=O)Nc1cccc(C#N)c1 |
| InChI | InChI=1S/C18H16N2O3S/c1-13(24-16-8-3-2-4-9-16)18(22)23-12-17(21)20-15-7-5-6-14(10-15)11-19/h2-10,13H,12H2,1H3,(H,20,21)/t13-/m0/s1 |
| InChIKey | LVCNIBZCJGGNTM-ZDUSSCGKSA-N |
| XLogP | 3.22 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.40 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |