C13H8ClF2NO — CID 2969912
4-chloro-N-(2,5-difluorophenyl)benzamide (PubChem CID 2969912) has the molecular formula C13H8ClF2NO and a molecular weight of 267.66 g/mol. Its IUPAC name is 4-chloro-N-(2,5-difluorophenyl)benzamide.
| Compound Name | 4-chloro-N-(2,5-difluorophenyl)benzamide |
|---|---|
| PubChem CID | 2969912 |
| Molecular Formula | C13H8ClF2NO |
| Molecular Weight | 267.66 g/mol |
| Exact Mass | 267.03 |
| IUPAC Name | 4-chloro-N-(2,5-difluorophenyl)benzamide |
| SMILES | O=C(Nc1cc(F)ccc1F)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C13H8ClF2NO/c14-9-3-1-8(2-4-9)13(18)17-12-7-10(15)5-6-11(12)16/h1-7H,(H,17,18) |
| InChIKey | PRCMACGXJMABAT-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.66 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |