C12H9F2N3O — CID 62152342
6-amino-N-(2,5-difluorophenyl)pyridine-3-carboxamide (PubChem CID 62152342) has the molecular formula C12H9F2N3O and a molecular weight of 249.22 g/mol. Its IUPAC name is 6-amino-N-(2,5-difluorophenyl)pyridine-3-carboxamide.
| Compound Name | 6-amino-N-(2,5-difluorophenyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 62152342 |
| Molecular Formula | C12H9F2N3O |
| Molecular Weight | 249.22 g/mol |
| Exact Mass | 249.07 |
| IUPAC Name | 6-amino-N-(2,5-difluorophenyl)pyridine-3-carboxamide |
| SMILES | Nc1ccc(C(=O)Nc2cc(F)ccc2F)cn1 |
| InChI | InChI=1S/C12H9F2N3O/c13-8-2-3-9(14)10(5-8)17-12(18)7-1-4-11(15)16-6-7/h1-6H,(H2,15,16)(H,17,18) |
| InChIKey | LABNRSIGQJNLDE-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.22 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |