C12H7F4N3O — CID 107642987
6-amino-N-(2,3,5,6-tetrafluorophenyl)pyridine-3-carboxamide (PubChem CID 107642987) has the molecular formula C12H7F4N3O and a molecular weight of 285.20 g/mol. Its IUPAC name is 6-amino-N-(2,3,5,6-tetrafluorophenyl)pyridine-3-carboxamide.
| Compound Name | 6-amino-N-(2,3,5,6-tetrafluorophenyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 107642987 |
| Molecular Formula | C12H7F4N3O |
| Molecular Weight | 285.20 g/mol |
| Exact Mass | 285.05 |
| IUPAC Name | 6-amino-N-(2,3,5,6-tetrafluorophenyl)pyridine-3-carboxamide |
| SMILES | Nc1ccc(C(=O)Nc2c(F)c(F)cc(F)c2F)cn1 |
| InChI | InChI=1S/C12H7F4N3O/c13-6-3-7(14)10(16)11(9(6)15)19-12(20)5-1-2-8(17)18-4-5/h1-4H,(H2,17,18)(H,19,20) |
| InChIKey | UDZUZOGMYUEADL-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.20 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|