C12H5BrF4N2O — CID 107641573
6-bromo-N-(2,3,5,6-tetrafluorophenyl)pyridine-3-carboxamide (PubChem CID 107641573) has the molecular formula C12H5BrF4N2O and a molecular weight of 349.08 g/mol. Its IUPAC name is 6-bromo-N-(2,3,5,6-tetrafluorophenyl)pyridine-3-carboxamide.
| Compound Name | 6-bromo-N-(2,3,5,6-tetrafluorophenyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 107641573 |
| Molecular Formula | C12H5BrF4N2O |
| Molecular Weight | 349.08 g/mol |
| Exact Mass | 347.95 |
| IUPAC Name | 6-bromo-N-(2,3,5,6-tetrafluorophenyl)pyridine-3-carboxamide |
| SMILES | O=C(Nc1c(F)c(F)cc(F)c1F)c1ccc(Br)nc1 |
| InChI | InChI=1S/C12H5BrF4N2O/c13-8-2-1-5(4-18-8)12(20)19-11-9(16)6(14)3-7(15)10(11)17/h1-4H,(H,19,20) |
| InChIKey | MTTOVDZYDKCGCU-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.08 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|