C13H5BrF5NO — CID 107953830
3-bromo-4-fluoro-N-(2,3,5,6-tetrafluorophenyl)benzamide (PubChem CID 107953830) has the molecular formula C13H5BrF5NO and a molecular weight of 366.08 g/mol. Its IUPAC name is 3-bromo-4-fluoro-N-(2,3,5,6-tetrafluorophenyl)benzamide.
| Compound Name | 3-bromo-4-fluoro-N-(2,3,5,6-tetrafluorophenyl)benzamide |
|---|---|
| PubChem CID | 107953830 |
| Molecular Formula | C13H5BrF5NO |
| Molecular Weight | 366.08 g/mol |
| Exact Mass | 364.95 |
| IUPAC Name | 3-bromo-4-fluoro-N-(2,3,5,6-tetrafluorophenyl)benzamide |
| SMILES | O=C(Nc1c(F)c(F)cc(F)c1F)c1ccc(F)c(Br)c1 |
| InChI | InChI=1S/C13H5BrF5NO/c14-6-3-5(1-2-7(6)15)13(21)20-12-10(18)8(16)4-9(17)11(12)19/h1-4H,(H,20,21) |
| InChIKey | DXSPCQYHXCPUNX-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.08 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|