C13H6BrF4NO — CID 103707329
3-bromo-4-fluoro-N-(2,4,5-trifluorophenyl)benzamide (PubChem CID 103707329) has the molecular formula C13H6BrF4NO and a molecular weight of 348.09 g/mol. Its IUPAC name is 3-bromo-4-fluoro-N-(2,4,5-trifluorophenyl)benzamide.
| Compound Name | 3-bromo-4-fluoro-N-(2,4,5-trifluorophenyl)benzamide |
|---|---|
| PubChem CID | 103707329 |
| Molecular Formula | C13H6BrF4NO |
| Molecular Weight | 348.09 g/mol |
| Exact Mass | 346.96 |
| IUPAC Name | 3-bromo-4-fluoro-N-(2,4,5-trifluorophenyl)benzamide |
| SMILES | O=C(Nc1cc(F)c(F)cc1F)c1ccc(F)c(Br)c1 |
| InChI | InChI=1S/C13H6BrF4NO/c14-7-3-6(1-2-8(7)15)13(20)19-12-5-10(17)9(16)4-11(12)18/h1-5H,(H,19,20) |
| InChIKey | PRXBXECZHUMNQS-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.09 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|