C14H10ClF2NO — CID 43333434
4-(chloromethyl)-N-(2,5-difluorophenyl)benzamide (PubChem CID 43333434) has the molecular formula C14H10ClF2NO and a molecular weight of 281.69 g/mol. Its IUPAC name is 4-(chloromethyl)-N-(2,5-difluorophenyl)benzamide.
| Compound Name | 4-(chloromethyl)-N-(2,5-difluorophenyl)benzamide |
|---|---|
| PubChem CID | 43333434 |
| Molecular Formula | C14H10ClF2NO |
| Molecular Weight | 281.69 g/mol |
| Exact Mass | 281.04 |
| IUPAC Name | 4-(chloromethyl)-N-(2,5-difluorophenyl)benzamide |
| SMILES | O=C(Nc1cc(F)ccc1F)c1ccc(CCl)cc1 |
| InChI | InChI=1S/C14H10ClF2NO/c15-8-9-1-3-10(4-2-9)14(19)18-13-7-11(16)5-6-12(13)17/h1-7H,8H2,(H,18,19) |
| InChIKey | QRLANGBLPOFEAE-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.69 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|