C19H13F2NO — CID 7958887
N-(2,5-difluorophenyl)-4-phenylbenzamide (PubChem CID 7958887) has the molecular formula C19H13F2NO and a molecular weight of 309.32 g/mol. Its IUPAC name is N-(2,5-difluorophenyl)-4-phenylbenzamide.
| Compound Name | N-(2,5-difluorophenyl)-4-phenylbenzamide |
|---|---|
| PubChem CID | 7958887 |
| Molecular Formula | C19H13F2NO |
| Molecular Weight | 309.32 g/mol |
| Exact Mass | 309.10 |
| IUPAC Name | N-(2,5-difluorophenyl)-4-phenylbenzamide |
| SMILES | O=C(Nc1cc(F)ccc1F)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C19H13F2NO/c20-16-10-11-17(21)18(12-16)22-19(23)15-8-6-14(7-9-15)13-4-2-1-3-5-13/h1-12H,(H,22,23) |
| InChIKey | HEUMQNPCJHICFW-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.32 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |