C13H7ClF3NO — CID 26361023
2-chloro-N-(2,5-difluorophenyl)-4-fluorobenzamide (PubChem CID 26361023) has the molecular formula C13H7ClF3NO and a molecular weight of 285.65 g/mol. Its IUPAC name is 2-chloro-N-(2,5-difluorophenyl)-4-fluorobenzamide.
| Compound Name | 2-chloro-N-(2,5-difluorophenyl)-4-fluorobenzamide |
|---|---|
| PubChem CID | 26361023 |
| Molecular Formula | C13H7ClF3NO |
| Molecular Weight | 285.65 g/mol |
| Exact Mass | 285.02 |
| IUPAC Name | 2-chloro-N-(2,5-difluorophenyl)-4-fluorobenzamide |
| SMILES | O=C(Nc1cc(F)ccc1F)c1ccc(F)cc1Cl |
| InChI | InChI=1S/C13H7ClF3NO/c14-10-5-7(15)1-3-9(10)13(19)18-12-6-8(16)2-4-11(12)17/h1-6H,(H,18,19) |
| InChIKey | XEWJTQQLPGRBJL-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.65 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |