C14H16ClN3O — CID 46226178
(2S)-2-(4-chlorophenyl)-3-methyl-N-(1H-pyrazol-5-yl)butanamide (PubChem CID 46226178) has the molecular formula C14H16ClN3O and a molecular weight of 277.75 g/mol. Its IUPAC name is (2S)-2-(4-chlorophenyl)-3-methyl-N-(1H-pyrazol-5-yl)butanamide.
| Compound Name | (2S)-2-(4-chlorophenyl)-3-methyl-N-(1H-pyrazol-5-yl)butanamide |
|---|---|
| PubChem CID | 46226178 |
| Molecular Formula | C14H16ClN3O |
| Molecular Weight | 277.75 g/mol |
| Exact Mass | 277.10 |
| IUPAC Name | (2S)-2-(4-chlorophenyl)-3-methyl-N-(1H-pyrazol-5-yl)butanamide |
| SMILES | CC(C)[C@H](C(=O)Nc1ccn[nH]1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C14H16ClN3O/c1-9(2)13(10-3-5-11(15)6-4-10)14(19)17-12-7-8-16-18-12/h3-9,13H,1-2H3,(H2,16,17,18,19)/t13-/m0/s1 |
| InChIKey | PCTOXJXHEDVEMG-ZDUSSCGKSA-N |
| XLogP | 3.44 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.75 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |