C14H22N2O2 — CID 116847946
5-tert-butyl-2-methoxy-N',N'-dimethylbenzohydrazide (PubChem CID 116847946) has the molecular formula C14H22N2O2 and a molecular weight of 250.34 g/mol. Its IUPAC name is 5-tert-butyl-2-methoxy-N',N'-dimethylbenzohydrazide.
| Compound Name | 5-tert-butyl-2-methoxy-N',N'-dimethylbenzohydrazide |
|---|---|
| PubChem CID | 116847946 |
| Molecular Formula | C14H22N2O2 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.17 |
| IUPAC Name | 5-tert-butyl-2-methoxy-N',N'-dimethylbenzohydrazide |
| SMILES | COc1ccc(C(C)(C)C)cc1C(=O)NN(C)C |
| InChI | InChI=1S/C14H22N2O2/c1-14(2,3)10-7-8-12(18-6)11(9-10)13(17)15-16(4)5/h7-9H,1-6H3,(H,15,17) |
| InChIKey | JGGQAAVRAFOHLF-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|