C14H21NO2 — CID 69030302
4-tert-butyl-2-methoxy-N,N-dimethylbenzamide (PubChem CID 69030302) has the molecular formula C14H21NO2 and a molecular weight of 235.33 g/mol. Its IUPAC name is 4-tert-butyl-2-methoxy-N,N-dimethylbenzamide.
| Compound Name | 4-tert-butyl-2-methoxy-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 69030302 |
| Molecular Formula | C14H21NO2 |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.16 |
| IUPAC Name | 4-tert-butyl-2-methoxy-N,N-dimethylbenzamide |
| SMILES | COc1cc(C(C)(C)C)ccc1C(=O)N(C)C |
| InChI | InChI=1S/C14H21NO2/c1-14(2,3)10-7-8-11(12(9-10)17-6)13(16)15(4)5/h7-9H,1-6H3 |
| InChIKey | SEVYRXAIXZCJMF-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |