About 4-tert-butyl-2-chloro-N,N-dimethylbenzamide
4-tert-butyl-2-chloro-N,N-dimethylbenzamide (PubChem CID 69030370) has the molecular formula C13H18ClNO
and a molecular weight of 239.75 g/mol. Its IUPAC name is 4-tert-butyl-2-chloro-N,N-dimethylbenzamide.
Molecular Properties
| Compound Name | 4-tert-butyl-2-chloro-N,N-dimethylbenzamide |
| PubChem CID | 69030370 |
| Molecular Formula | C13H18ClNO |
| Molecular Weight | 239.75 g/mol |
| Exact Mass | 239.11 |
| IUPAC Name | 4-tert-butyl-2-chloro-N,N-dimethylbenzamide |
| SMILES | CN(C)C(=O)c1ccc(C(C)(C)C)cc1Cl |
| InChI | InChI=1S/C13H18ClNO/c1-13(2,3)9-6-7-10(11(14)8-9)12(16)15(4)5/h6-8H,1-5H3 |
| InChIKey | ZUVSCXSNVXTDTA-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.75 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-tert-butyl-2-chloro-N,N-dimethylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-tert-butyl-2-chloro-N,N-dimethylbenzamide?
The IUPAC name of 4-tert-butyl-2-chloro-N,N-dimethylbenzamide (CID 69030370) is 4-tert-butyl-2-chloro-N,N-dimethylbenzamide.
What is the SMILES notation for 4-tert-butyl-2-chloro-N,N-dimethylbenzamide?
The canonical SMILES for 4-tert-butyl-2-chloro-N,N-dimethylbenzamide is CN(C)C(=O)c1ccc(C(C)(C)C)cc1Cl.
What is the InChIKey of 4-tert-butyl-2-chloro-N,N-dimethylbenzamide?
The InChIKey is ZUVSCXSNVXTDTA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18ClNO/c1-13(2,3)9-6-7-10(11(14)8-9)12(16)15(4)5/h6-8H,1-5H3.
What are the key properties of 4-tert-butyl-2-chloro-N,N-dimethylbenzamide?
4-tert-butyl-2-chloro-N,N-dimethylbenzamide has a molecular weight of 239.75 g/mol, XLogP of 3.34, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-tert-butyl-2-chloro-N,N-dimethylbenzamide is sourced from PubChem (CID 69030370), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).