C13H18ClNO — CID 69030370
4-tert-butyl-2-chloro-N,N-dimethylbenzamide (PubChem CID 69030370) has the molecular formula C13H18ClNO and a molecular weight of 239.75 g/mol. Its IUPAC name is 4-tert-butyl-2-chloro-N,N-dimethylbenzamide.
| Compound Name | 4-tert-butyl-2-chloro-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 69030370 |
| Molecular Formula | C13H18ClNO |
| Molecular Weight | 239.75 g/mol |
| Exact Mass | 239.11 |
| IUPAC Name | 4-tert-butyl-2-chloro-N,N-dimethylbenzamide |
| SMILES | CN(C)C(=O)c1ccc(C(C)(C)C)cc1Cl |
| InChI | InChI=1S/C13H18ClNO/c1-13(2,3)9-6-7-10(11(14)8-9)12(16)15(4)5/h6-8H,1-5H3 |
| InChIKey | ZUVSCXSNVXTDTA-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.75 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |