C13H19N3O5 — CID 83005503
2-(4,5-dimethoxy-2-nitroanilino)-N,N-dimethylpropanamide (PubChem CID 83005503) has the molecular formula C13H19N3O5 and a molecular weight of 297.31 g/mol. Its IUPAC name is 2-(4,5-dimethoxy-2-nitroanilino)-N,N-dimethylpropanamide.
| Compound Name | 2-(4,5-dimethoxy-2-nitroanilino)-N,N-dimethylpropanamide |
|---|---|
| PubChem CID | 83005503 |
| Molecular Formula | C13H19N3O5 |
| Molecular Weight | 297.31 g/mol |
| Exact Mass | 297.13 |
| IUPAC Name | 2-(4,5-dimethoxy-2-nitroanilino)-N,N-dimethylpropanamide |
| SMILES | COc1cc(NC(C)C(=O)N(C)C)c([N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C13H19N3O5/c1-8(13(17)15(2)3)14-9-6-11(20-4)12(21-5)7-10(9)16(18)19/h6-8,14H,1-5H3 |
| InChIKey | XLKMWIRYXKHCIW-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 93.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.31 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|